C14H17N3O2 — CID 54206736
2-phenyldiazenyl-1-pyrrolidin-1-ylbutane-1,3-dione (PubChem CID 54206736) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-phenyldiazenyl-1-pyrrolidin-1-ylbutane-1,3-dione.
| Compound Name | 2-phenyldiazenyl-1-pyrrolidin-1-ylbutane-1,3-dione |
|---|---|
| PubChem CID | 54206736 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 2-phenyldiazenyl-1-pyrrolidin-1-ylbutane-1,3-dione |
| SMILES | CC(=O)C(/N=N/c1ccccc1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C14H17N3O2/c1-11(18)13(14(19)17-9-5-6-10-17)16-15-12-7-3-2-4-8-12/h2-4,7-8,13H,5-6,9-10H2,1H3/b16-15+ |
| InChIKey | PTACHRSLLRIJDB-FOCLMDBBSA-N |
| XLogP | 2.35 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|