C22H18NO2S+ — CID 54207335
3-methyl-6-(2-methylphenoxy)-6H-[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium (PubChem CID 54207335) has the molecular formula C22H18NO2S+ and a molecular weight of 360.46 g/mol. Its IUPAC name is 3-methyl-6-(2-methylphenoxy)-6H-[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium.
| Compound Name | 3-methyl-6-(2-methylphenoxy)-6H-[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium |
|---|---|
| PubChem CID | 54207335 |
| Molecular Formula | C22H18NO2S+ |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 3-methyl-6-(2-methylphenoxy)-6H-[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium |
| SMILES | Cc1ccc2c(c1)OC(Oc1ccccc1C)[n+]1c-2sc2ccccc21 |
| InChI | InChI=1S/C22H18NO2S/c1-14-11-12-16-19(13-14)25-22(24-18-9-5-3-7-15(18)2)23-17-8-4-6-10-20(17)26-21(16)23/h3-13,22H,1-2H3/q+1 |
| InChIKey | BVQVHYAPFRHNPD-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|