About [2-(N-tert-butylanilino)-2-oxoethyl] N-propan-2-ylsulfamate
[2-(N-tert-butylanilino)-2-oxoethyl] N-propan-2-ylsulfamate (PubChem CID 54207985) has the molecular formula C15H24N2O4S
and a molecular weight of 328.43 g/mol. Its IUPAC name is [2-(N-tert-butylanilino)-2-oxoethyl] N-propan-2-ylsulfamate.
Molecular Properties
| Compound Name | [2-(N-tert-butylanilino)-2-oxoethyl] N-propan-2-ylsulfamate |
| PubChem CID | 54207985 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | [2-(N-tert-butylanilino)-2-oxoethyl] N-propan-2-ylsulfamate |
| SMILES | CC(C)NS(=O)(=O)OCC(=O)N(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C15H24N2O4S/c1-12(2)16-22(19,20)21-11-14(18)17(15(3,4)5)13-9-7-6-8-10-13/h6-10,12,16H,11H2,1-5H3 |
| InChIKey | PTWYVENVZWLFHL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(N-tert-butylanilino)-2-oxoethyl] N-propan-2-ylsulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(N-tert-butylanilino)-2-oxoethyl] N-propan-2-ylsulfamate?
The IUPAC name of [2-(N-tert-butylanilino)-2-oxoethyl] N-propan-2-ylsulfamate (CID 54207985) is [2-(N-tert-butylanilino)-2-oxoethyl] N-propan-2-ylsulfamate.
What is the SMILES notation for [2-(N-tert-butylanilino)-2-oxoethyl] N-propan-2-ylsulfamate?
The canonical SMILES for [2-(N-tert-butylanilino)-2-oxoethyl] N-propan-2-ylsulfamate is CC(C)NS(=O)(=O)OCC(=O)N(c1ccccc1)C(C)(C)C.
What is the InChIKey of [2-(N-tert-butylanilino)-2-oxoethyl] N-propan-2-ylsulfamate?
The InChIKey is PTWYVENVZWLFHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O4S/c1-12(2)16-22(19,20)21-11-14(18)17(15(3,4)5)13-9-7-6-8-10-13/h6-10,12,16H,11H2,1-5H3.
What are the key properties of [2-(N-tert-butylanilino)-2-oxoethyl] N-propan-2-ylsulfamate?
[2-(N-tert-butylanilino)-2-oxoethyl] N-propan-2-ylsulfamate has a molecular weight of 328.43 g/mol, XLogP of 2.08, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(N-tert-butylanilino)-2-oxoethyl] N-propan-2-ylsulfamate is sourced from PubChem (CID 54207985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).