C48H38N4O2 — CID 54208632
4-[10,15,20-tris(4-methylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzoic acid (PubChem CID 54208632) has the molecular formula C48H38N4O2 and a molecular weight of 702.86 g/mol. Its IUPAC name is 4-[10,15,20-tris(4-methylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzoic acid.
| Compound Name | 4-[10,15,20-tris(4-methylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 54208632 |
| Molecular Formula | C48H38N4O2 |
| Molecular Weight | 702.86 g/mol |
| Exact Mass | 702.30 |
| IUPAC Name | 4-[10,15,20-tris(4-methylphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]benzoic acid |
| SMILES | Cc1ccc(C2=c3ccc([nH]3)=C(c3ccc(C)cc3)c3ccc([nH]3)C(c3ccc(C(=O)O)cc3)=c3ccc([nH]3)=C(c3ccc(C)cc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C48H38N4O2/c1-28-4-10-31(11-5-28)44-36-20-22-38(49-36)45(32-12-6-29(2)7-13-32)40-24-26-42(51-40)47(34-16-18-35(19-17-34)48(53)54)43-27-25-41(52-43)46(39-23-21-37(44)50-39)33-14-8-30(3)9-15-33/h4-27,49-52H,1-3H3,(H,53,54) |
| InChIKey | YDWCZTHWXTWLDH-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.86 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 1 |