C24H27F2N3O — CID 54208633
5-(2,3-difluoro-4-octoxyphenyl)-2-(6-methyl-3-pyridinyl)pyrimidine (PubChem CID 54208633) has the molecular formula C24H27F2N3O and a molecular weight of 411.50 g/mol. Its IUPAC name is 5-(2,3-difluoro-4-octoxyphenyl)-2-(6-methyl-3-pyridinyl)pyrimidine.
| Compound Name | 5-(2,3-difluoro-4-octoxyphenyl)-2-(6-methyl-3-pyridinyl)pyrimidine |
|---|---|
| PubChem CID | 54208633 |
| Molecular Formula | C24H27F2N3O |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 5-(2,3-difluoro-4-octoxyphenyl)-2-(6-methyl-3-pyridinyl)pyrimidine |
| SMILES | CCCCCCCCOc1ccc(-c2cnc(-c3ccc(C)nc3)nc2)c(F)c1F |
| InChI | InChI=1S/C24H27F2N3O/c1-3-4-5-6-7-8-13-30-21-12-11-20(22(25)23(21)26)19-15-28-24(29-16-19)18-10-9-17(2)27-14-18/h9-12,14-16H,3-8,13H2,1-2H3 |
| InChIKey | PUIJVMYNPCMOKY-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|