C18H16N2 — CID 54211564
2,13-diazapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),4,6,8,10,12,14-heptaene (PubChem CID 54211564) has the molecular formula C18H16N2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2,13-diazapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),4,6,8,10,12,14-heptaene.
| Compound Name | 2,13-diazapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),4,6,8,10,12,14-heptaene |
|---|---|
| PubChem CID | 54211564 |
| Molecular Formula | C18H16N2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2,13-diazapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),4,6,8,10,12,14-heptaene |
| SMILES | C1=CC2=Cc3cccc4c3=C(C3CCCC=C3N=4)N2C1 |
| InChI | InChI=1S/C18H16N2/c1-2-8-15-14(7-1)18-17-12(5-3-9-16(17)19-15)11-13-6-4-10-20(13)18/h3-6,8-9,11,14H,1-2,7,10H2 |
| InChIKey | PWHRZYDPBZRMQW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |