C33H33N5O7S — CID 54215016
N-[5-(2-methoxyphenoxy)-2-(1-oxidopyridin-1-ium-4-yl)-6-(2-phenylmethoxyethoxy)pyrimidin-4-yl]-5-propan-2-ylpyridine-2-sulfonamide (PubChem CID 54215016) has the molecular formula C33H33N5O7S and a molecular weight of 643.72 g/mol. Its IUPAC name is N-[5-(2-methoxyphenoxy)-2-(1-oxidopyridin-1-ium-4-yl)-6-(2-phenylmethoxyethoxy)pyrimidin-4-yl]-5-propan-2-ylpyridine-2-sulfonamide.
| Compound Name | N-[5-(2-methoxyphenoxy)-2-(1-oxidopyridin-1-ium-4-yl)-6-(2-phenylmethoxyethoxy)pyrimidin-4-yl]-5-propan-2-ylpyridine-2-sulfonamide |
|---|---|
| PubChem CID | 54215016 |
| Molecular Formula | C33H33N5O7S |
| Molecular Weight | 643.72 g/mol |
| Exact Mass | 643.21 |
| IUPAC Name | N-[5-(2-methoxyphenoxy)-2-(1-oxidopyridin-1-ium-4-yl)-6-(2-phenylmethoxyethoxy)pyrimidin-4-yl]-5-propan-2-ylpyridine-2-sulfonamide |
| SMILES | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2cc[n+]([O-])cc2)nc1OCCOCc1ccccc1 |
| InChI | InChI=1S/C33H33N5O7S/c1-23(2)26-13-14-29(34-21-26)46(40,41)37-32-30(45-28-12-8-7-11-27(28)42-3)33(36-31(35-32)25-15-17-38(39)18-16-25)44-20-19-43-22-24-9-5-4-6-10-24/h4-18,21,23H,19-20,22H2,1-3H3,(H,35,36,37) |
| InChIKey | PYOHQFSOOSFGAP-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 148.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.72 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|