C32H34N10O12S — CID 25094203
2-[5-(2-methoxyphenoxy)-6-[(5-propan-2-yl-2-pyridinyl)sulfonylamino]-2-[2-(2H-tetrazol-5-yl)-4-pyridinyl]pyrimidin-4-yl]oxyethyl 2-(2-nitrooxyethoxy)ethyl carbonate (PubChem CID 25094203) has the molecular formula C32H34N10O12S and a molecular weight of 782.75 g/mol. Its IUPAC name is 2-[5-(2-methoxyphenoxy)-6-[(5-propan-2-yl-2-pyridinyl)sulfonylamino]-2-[2-(2H-tetrazol-5-yl)-4-pyridinyl]pyrimidin-4-yl]oxyethyl 2-(2-nitrooxyethoxy)ethyl carbonate.
| Compound Name | 2-[5-(2-methoxyphenoxy)-6-[(5-propan-2-yl-2-pyridinyl)sulfonylamino]-2-[2-(2H-tetrazol-5-yl)-4-pyridinyl]pyrimidin-4-yl]oxyethyl 2-(2-nitrooxyethoxy)ethyl carbonate |
|---|---|
| PubChem CID | 25094203 |
| Molecular Formula | C32H34N10O12S |
| Molecular Weight | 782.75 g/mol |
| Exact Mass | 782.21 |
| IUPAC Name | 2-[5-(2-methoxyphenoxy)-6-[(5-propan-2-yl-2-pyridinyl)sulfonylamino]-2-[2-(2H-tetrazol-5-yl)-4-pyridinyl]pyrimidin-4-yl]oxyethyl 2-(2-nitrooxyethoxy)ethyl carbonate |
| SMILES | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ccnc(-c3nn[nH]n3)c2)nc1OCCOC(=O)OCCOCCO[N+](=O)[O-] |
| InChI | InChI=1S/C32H34N10O12S/c1-20(2)22-8-9-26(34-19-22)55(46,47)39-30-27(54-25-7-5-4-6-24(25)48-3)31(50-15-16-52-32(43)51-14-12-49-13-17-53-42(44)45)36-28(35-30)21-10-11-33-23(18-21)29-37-40-41-38-29/h4-11,18-20H,12-17H2,1-3H3,(H,35,36,39)(H,37,38,40,41) |
| InChIKey | AKLDJDLOGQWFIZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 277.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.75 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|