C33H28N10O10S — CID 25093771
2-[5-(2-methoxyphenoxy)-6-[(5-methyl-2-pyridinyl)sulfonylamino]-2-[2-(2H-tetrazol-5-yl)-4-pyridinyl]pyrimidin-4-yl]oxyethyl 4-(nitrooxymethyl)benzoate (PubChem CID 25093771) has the molecular formula C33H28N10O10S and a molecular weight of 756.71 g/mol. Its IUPAC name is 2-[5-(2-methoxyphenoxy)-6-[(5-methyl-2-pyridinyl)sulfonylamino]-2-[2-(2H-tetrazol-5-yl)-4-pyridinyl]pyrimidin-4-yl]oxyethyl 4-(nitrooxymethyl)benzoate.
| Compound Name | 2-[5-(2-methoxyphenoxy)-6-[(5-methyl-2-pyridinyl)sulfonylamino]-2-[2-(2H-tetrazol-5-yl)-4-pyridinyl]pyrimidin-4-yl]oxyethyl 4-(nitrooxymethyl)benzoate |
|---|---|
| PubChem CID | 25093771 |
| Molecular Formula | C33H28N10O10S |
| Molecular Weight | 756.71 g/mol |
| Exact Mass | 756.17 |
| IUPAC Name | 2-[5-(2-methoxyphenoxy)-6-[(5-methyl-2-pyridinyl)sulfonylamino]-2-[2-(2H-tetrazol-5-yl)-4-pyridinyl]pyrimidin-4-yl]oxyethyl 4-(nitrooxymethyl)benzoate |
| SMILES | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(-c2ccnc(-c3nn[nH]n3)c2)nc1OCCOC(=O)c1ccc(CO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C33H28N10O10S/c1-20-7-12-27(35-18-20)54(47,48)40-31-28(53-26-6-4-3-5-25(26)49-2)32(37-29(36-31)23-13-14-34-24(17-23)30-38-41-42-39-30)50-15-16-51-33(44)22-10-8-21(9-11-22)19-52-43(45)46/h3-14,17-18H,15-16,19H2,1-2H3,(H,36,37,40)(H,38,39,41,42) |
| InChIKey | VQYCETHGZREGND-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 258.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.71 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|