C34H41N11O14S — CID 70639527
5,6-bis[(dihydroxyamino)oxy]hexyl 2-[5-(2-methoxyphenoxy)-6-[(5-propan-2-yl-2-pyridinyl)sulfonylamino]-2-[2-(2H-tetrazol-5-yl)-4-pyridinyl]pyrimidin-4-yl]oxyethyl carbonate (PubChem CID 70639527) has the molecular formula C34H41N11O14S and a molecular weight of 859.83 g/mol. Its IUPAC name is 5,6-bis[(dihydroxyamino)oxy]hexyl 2-[5-(2-methoxyphenoxy)-6-[(5-propan-2-yl-2-pyridinyl)sulfonylamino]-2-[2-(2H-tetrazol-5-yl)-4-pyridinyl]pyrimidin-4-yl]oxyethyl carbonate.
| Compound Name | 5,6-bis[(dihydroxyamino)oxy]hexyl 2-[5-(2-methoxyphenoxy)-6-[(5-propan-2-yl-2-pyridinyl)sulfonylamino]-2-[2-(2H-tetrazol-5-yl)-4-pyridinyl]pyrimidin-4-yl]oxyethyl carbonate |
|---|---|
| PubChem CID | 70639527 |
| Molecular Formula | C34H41N11O14S |
| Molecular Weight | 859.83 g/mol |
| Exact Mass | 859.26 |
| IUPAC Name | 5,6-bis[(dihydroxyamino)oxy]hexyl 2-[5-(2-methoxyphenoxy)-6-[(5-propan-2-yl-2-pyridinyl)sulfonylamino]-2-[2-(2H-tetrazol-5-yl)-4-pyridinyl]pyrimidin-4-yl]oxyethyl carbonate |
| SMILES | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)nc(-c2ccnc(-c3nn[nH]n3)c2)nc1OCCOC(=O)OCCCCC(CON(O)O)ON(O)O |
| InChI | InChI=1S/C34H41N11O14S/c1-21(2)23-11-12-28(36-19-23)60(51,52)41-32-29(58-27-10-5-4-9-26(27)53-3)33(38-30(37-32)22-13-14-35-25(18-22)31-39-42-43-40-31)54-16-17-56-34(46)55-15-7-6-8-24(59-45(49)50)20-57-44(47)48/h4-5,9-14,18-19,21,24,47-50H,6-8,15-17,20H2,1-3H3,(H,37,38,41)(H,39,40,42,43) |
| InChIKey | FYTDNZOEULJABK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 321.27 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 23 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.83 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 23 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|