C22H16F3NO — CID 54215848
4-(4-phenylphenyl)-2-(2,4,5-trifluorophenyl)-5,6-dihydro-4H-1,3-oxazine (PubChem CID 54215848) has the molecular formula C22H16F3NO and a molecular weight of 367.37 g/mol. Its IUPAC name is 4-(4-phenylphenyl)-2-(2,4,5-trifluorophenyl)-5,6-dihydro-4H-1,3-oxazine.
| Compound Name | 4-(4-phenylphenyl)-2-(2,4,5-trifluorophenyl)-5,6-dihydro-4H-1,3-oxazine |
|---|---|
| PubChem CID | 54215848 |
| Molecular Formula | C22H16F3NO |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 4-(4-phenylphenyl)-2-(2,4,5-trifluorophenyl)-5,6-dihydro-4H-1,3-oxazine |
| SMILES | Fc1cc(F)c(C2=NC(c3ccc(-c4ccccc4)cc3)CCO2)cc1F |
| InChI | InChI=1S/C22H16F3NO/c23-18-13-20(25)19(24)12-17(18)22-26-21(10-11-27-22)16-8-6-15(7-9-16)14-4-2-1-3-5-14/h1-9,12-13,21H,10-11H2 |
| InChIKey | PZCVSZKOJSZRIN-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|