C20H33NO2 — CID 54216217
(4-cyano-4-propylcyclohexyl) 4-propylcyclohexane-1-carboxylate (PubChem CID 54216217) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is (4-cyano-4-propylcyclohexyl) 4-propylcyclohexane-1-carboxylate.
| Compound Name | (4-cyano-4-propylcyclohexyl) 4-propylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 54216217 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | (4-cyano-4-propylcyclohexyl) 4-propylcyclohexane-1-carboxylate |
| SMILES | CCCC1CCC(C(=O)OC2CCC(C#N)(CCC)CC2)CC1 |
| InChI | InChI=1S/C20H33NO2/c1-3-5-16-6-8-17(9-7-16)19(22)23-18-10-13-20(15-21,12-4-2)14-11-18/h16-18H,3-14H2,1-2H3 |
| InChIKey | PZJGZFZUPDKLRC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |