C19H36NO6PS — CID 54216895
ethyl 6-(2-amino-3-methoxy-3-oxopropyl)sulfanyl-2-[[ethoxy(2-methylpropyl)phosphoryl]methyl]hex-2-enoate (PubChem CID 54216895) has the molecular formula C19H36NO6PS and a molecular weight of 437.54 g/mol. Its IUPAC name is ethyl 6-(2-amino-3-methoxy-3-oxopropyl)sulfanyl-2-[[ethoxy(2-methylpropyl)phosphoryl]methyl]hex-2-enoate.
| Compound Name | ethyl 6-(2-amino-3-methoxy-3-oxopropyl)sulfanyl-2-[[ethoxy(2-methylpropyl)phosphoryl]methyl]hex-2-enoate |
|---|---|
| PubChem CID | 54216895 |
| Molecular Formula | C19H36NO6PS |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | ethyl 6-(2-amino-3-methoxy-3-oxopropyl)sulfanyl-2-[[ethoxy(2-methylpropyl)phosphoryl]methyl]hex-2-enoate |
| SMILES | CCOC(=O)C(=CCCCSCC(N)C(=O)OC)CP(=O)(CC(C)C)OCC |
| InChI | InChI=1S/C19H36NO6PS/c1-6-25-18(21)16(13-27(23,26-7-2)12-15(3)4)10-8-9-11-28-14-17(20)19(22)24-5/h10,15,17H,6-9,11-14,20H2,1-5H3 |
| InChIKey | PZUYEISIKKZLMQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|