About 5-iodopentan-2-yl (2R)-2-amino-3-(4-hydroxypentylsulfanyl)propanoate
5-iodopentan-2-yl (2R)-2-amino-3-(4-hydroxypentylsulfanyl)propanoate (PubChem CID 57278815) has the molecular formula C13H26INO3S
and a molecular weight of 403.33 g/mol. Its IUPAC name is 5-iodopentan-2-yl (2R)-2-amino-3-(4-hydroxypentylsulfanyl)propanoate.
Molecular Properties
| Compound Name | 5-iodopentan-2-yl (2R)-2-amino-3-(4-hydroxypentylsulfanyl)propanoate |
| PubChem CID | 57278815 |
| Molecular Formula | C13H26INO3S |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 5-iodopentan-2-yl (2R)-2-amino-3-(4-hydroxypentylsulfanyl)propanoate |
| SMILES | CC(O)CCCSC[C@H](N)C(=O)OC(C)CCCI |
| InChI | InChI=1S/C13H26INO3S/c1-10(16)5-4-8-19-9-12(15)13(17)18-11(2)6-3-7-14/h10-12,16H,3-9,15H2,1-2H3/t10?,11?,12-/m0/s1 |
| InChIKey | FRDYKDVZFAIKLO-MCIGGMRASA-N |
| XLogP | 2.35 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodopentan-2-yl (2R)-2-amino-3-(4-hydroxypentylsulfanyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodopentan-2-yl (2R)-2-amino-3-(4-hydroxypentylsulfanyl)propanoate?
The IUPAC name of 5-iodopentan-2-yl (2R)-2-amino-3-(4-hydroxypentylsulfanyl)propanoate (CID 57278815) is 5-iodopentan-2-yl (2R)-2-amino-3-(4-hydroxypentylsulfanyl)propanoate.
What is the SMILES notation for 5-iodopentan-2-yl (2R)-2-amino-3-(4-hydroxypentylsulfanyl)propanoate?
The canonical SMILES for 5-iodopentan-2-yl (2R)-2-amino-3-(4-hydroxypentylsulfanyl)propanoate is CC(O)CCCSC[C@H](N)C(=O)OC(C)CCCI.
What is the InChIKey of 5-iodopentan-2-yl (2R)-2-amino-3-(4-hydroxypentylsulfanyl)propanoate?
The InChIKey is FRDYKDVZFAIKLO-MCIGGMRASA-N. The full InChI is InChI=1S/C13H26INO3S/c1-10(16)5-4-8-19-9-12(15)13(17)18-11(2)6-3-7-14/h10-12,16H,3-9,15H2,1-2H3/t10?,11?,12-/m0/s1.
What are the key properties of 5-iodopentan-2-yl (2R)-2-amino-3-(4-hydroxypentylsulfanyl)propanoate?
5-iodopentan-2-yl (2R)-2-amino-3-(4-hydroxypentylsulfanyl)propanoate has a molecular weight of 403.33 g/mol, XLogP of 2.35, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodopentan-2-yl (2R)-2-amino-3-(4-hydroxypentylsulfanyl)propanoate is sourced from PubChem (CID 57278815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).