C10H9Cl2F — CID 54219204
1-(2,4-dichlorobut-2-enyl)-2-fluorobenzene (PubChem CID 54219204) has the molecular formula C10H9Cl2F and a molecular weight of 219.09 g/mol. Its IUPAC name is 1-(2,4-dichlorobut-2-enyl)-2-fluorobenzene.
| Compound Name | 1-(2,4-dichlorobut-2-enyl)-2-fluorobenzene |
|---|---|
| PubChem CID | 54219204 |
| Molecular Formula | C10H9Cl2F |
| Molecular Weight | 219.09 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | 1-(2,4-dichlorobut-2-enyl)-2-fluorobenzene |
| SMILES | Fc1ccccc1CC(Cl)=CCCl |
| InChI | InChI=1S/C10H9Cl2F/c11-6-5-9(12)7-8-3-1-2-4-10(8)13/h1-5H,6-7H2 |
| InChIKey | QBIPGYZYGMGLHK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.09 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|