About quinazoline-2,8-dione
quinazoline-2,8-dione (PubChem CID 54222054) has the molecular formula C8H4N2O2
and a molecular weight of 160.13 g/mol. Its IUPAC name is quinazoline-2,8-dione.
Molecular Properties
| Compound Name | quinazoline-2,8-dione |
| PubChem CID | 54222054 |
| Molecular Formula | C8H4N2O2 |
| Molecular Weight | 160.13 g/mol |
| Exact Mass | 160.03 |
| IUPAC Name | quinazoline-2,8-dione |
| SMILES | O=C1N=CC2=CC=CC(=O)C2=N1 |
| InChI | InChI=1S/C8H4N2O2/c11-6-3-1-2-5-4-9-8(12)10-7(5)6/h1-4H |
| InChIKey | QDHBLSGCGZLRGJ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.13 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'} |
|---|
Analyze quinazoline-2,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinazoline-2,8-dione?
The IUPAC name of quinazoline-2,8-dione (CID 54222054) is quinazoline-2,8-dione.
What is the SMILES notation for quinazoline-2,8-dione?
The canonical SMILES for quinazoline-2,8-dione is O=C1N=CC2=CC=CC(=O)C2=N1.
What is the InChIKey of quinazoline-2,8-dione?
The InChIKey is QDHBLSGCGZLRGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2O2/c11-6-3-1-2-5-4-9-8(12)10-7(5)6/h1-4H.
What are the key properties of quinazoline-2,8-dione?
quinazoline-2,8-dione has a molecular weight of 160.13 g/mol, XLogP of 0.70, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinazoline-2,8-dione is sourced from PubChem (CID 54222054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).