C23H28N2S — CID 54224037
4-[[4-(dimethylamino)-2-methylphenyl]-thiophen-2-ylmethyl]-N,N,3-trimethylaniline (PubChem CID 54224037) has the molecular formula C23H28N2S and a molecular weight of 364.56 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)-2-methylphenyl]-thiophen-2-ylmethyl]-N,N,3-trimethylaniline.
| Compound Name | 4-[[4-(dimethylamino)-2-methylphenyl]-thiophen-2-ylmethyl]-N,N,3-trimethylaniline |
|---|---|
| PubChem CID | 54224037 |
| Molecular Formula | C23H28N2S |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 4-[[4-(dimethylamino)-2-methylphenyl]-thiophen-2-ylmethyl]-N,N,3-trimethylaniline |
| SMILES | Cc1cc(N(C)C)ccc1C(c1cccs1)c1ccc(N(C)C)cc1C |
| InChI | InChI=1S/C23H28N2S/c1-16-14-18(24(3)4)9-11-20(16)23(22-8-7-13-26-22)21-12-10-19(25(5)6)15-17(21)2/h7-15,23H,1-6H3 |
| InChIKey | QEPNGWBKLKGVES-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|