C23H33N3O2 — CID 54224181
2-[4-[4-(2-methylphenyl)piperazin-1-yl]butyl]-4,5,6,7-tetrahydroisoindole-1,3-diol (PubChem CID 54224181) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 2-[4-[4-(2-methylphenyl)piperazin-1-yl]butyl]-4,5,6,7-tetrahydroisoindole-1,3-diol.
| Compound Name | 2-[4-[4-(2-methylphenyl)piperazin-1-yl]butyl]-4,5,6,7-tetrahydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 54224181 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 2-[4-[4-(2-methylphenyl)piperazin-1-yl]butyl]-4,5,6,7-tetrahydroisoindole-1,3-diol |
| SMILES | Cc1ccccc1N1CCN(CCCCn2c(O)c3c(c2O)CCCC3)CC1 |
| InChI | InChI=1S/C23H33N3O2/c1-18-8-2-5-11-21(18)25-16-14-24(15-17-25)12-6-7-13-26-22(27)19-9-3-4-10-20(19)23(26)28/h2,5,8,11,27-28H,3-4,6-7,9-10,12-17H2,1H3 |
| InChIKey | QERXRCHFOMDPCO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 51.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|