About acetyl fluoride;1-fluoro-3-(methylamino)butan-2-one
acetyl fluoride;1-fluoro-3-(methylamino)butan-2-one (PubChem CID 54224329) has the molecular formula C7H13F2NO2
and a molecular weight of 181.18 g/mol. Its IUPAC name is acetyl fluoride;1-fluoro-3-(methylamino)butan-2-one.
Molecular Properties
| Compound Name | acetyl fluoride;1-fluoro-3-(methylamino)butan-2-one |
| PubChem CID | 54224329 |
| Molecular Formula | C7H13F2NO2 |
| Molecular Weight | 181.18 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | acetyl fluoride;1-fluoro-3-(methylamino)butan-2-one |
| SMILES | CC(=O)F.CNC(C)C(=O)CF |
| InChI | InChI=1S/C5H10FNO.C2H3FO/c1-4(7-2)5(8)3-6;1-2(3)4/h4,7H,3H2,1-2H3;1H3 |
| InChIKey | QEUIBGHJBLTRNA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.18 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze acetyl fluoride;1-fluoro-3-(methylamino)butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl fluoride;1-fluoro-3-(methylamino)butan-2-one?
The IUPAC name of acetyl fluoride;1-fluoro-3-(methylamino)butan-2-one (CID 54224329) is acetyl fluoride;1-fluoro-3-(methylamino)butan-2-one.
What is the SMILES notation for acetyl fluoride;1-fluoro-3-(methylamino)butan-2-one?
The canonical SMILES for acetyl fluoride;1-fluoro-3-(methylamino)butan-2-one is CC(=O)F.CNC(C)C(=O)CF.
What is the InChIKey of acetyl fluoride;1-fluoro-3-(methylamino)butan-2-one?
The InChIKey is QEUIBGHJBLTRNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10FNO.C2H3FO/c1-4(7-2)5(8)3-6;1-2(3)4/h4,7H,3H2,1-2H3;1H3.
What are the key properties of acetyl fluoride;1-fluoro-3-(methylamino)butan-2-one?
acetyl fluoride;1-fluoro-3-(methylamino)butan-2-one has a molecular weight of 181.18 g/mol, XLogP of 0.64, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl fluoride;1-fluoro-3-(methylamino)butan-2-one is sourced from PubChem (CID 54224329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).