C12H24N4S2 — CID 54225744
3-(3-butan-2-ylpiperazin-1-yl)-N,N-dimethyl-3H-1,2,4-dithiazol-5-amine (PubChem CID 54225744) has the molecular formula C12H24N4S2 and a molecular weight of 288.49 g/mol. Its IUPAC name is 3-(3-butan-2-ylpiperazin-1-yl)-N,N-dimethyl-3H-1,2,4-dithiazol-5-amine.
| Compound Name | 3-(3-butan-2-ylpiperazin-1-yl)-N,N-dimethyl-3H-1,2,4-dithiazol-5-amine |
|---|---|
| PubChem CID | 54225744 |
| Molecular Formula | C12H24N4S2 |
| Molecular Weight | 288.49 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 3-(3-butan-2-ylpiperazin-1-yl)-N,N-dimethyl-3H-1,2,4-dithiazol-5-amine |
| SMILES | CCC(C)C1CN(C2N=C(N(C)C)SS2)CCN1 |
| InChI | InChI=1S/C12H24N4S2/c1-5-9(2)10-8-16(7-6-13-10)12-14-11(15(3)4)17-18-12/h9-10,12-13H,5-8H2,1-4H3 |
| InChIKey | QFSQRDINEAXJAD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|