C32H30N4O3 — CID 54226545
methyl 2-[(3-carbamimidoylphenyl)methyl]-5-phenyl-3-[(4-pyridin-4-ylbenzoyl)amino]pent-4-enoate (PubChem CID 54226545) has the molecular formula C32H30N4O3 and a molecular weight of 518.62 g/mol. Its IUPAC name is methyl 2-[(3-carbamimidoylphenyl)methyl]-5-phenyl-3-[(4-pyridin-4-ylbenzoyl)amino]pent-4-enoate.
| Compound Name | methyl 2-[(3-carbamimidoylphenyl)methyl]-5-phenyl-3-[(4-pyridin-4-ylbenzoyl)amino]pent-4-enoate |
|---|---|
| PubChem CID | 54226545 |
| Molecular Formula | C32H30N4O3 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | methyl 2-[(3-carbamimidoylphenyl)methyl]-5-phenyl-3-[(4-pyridin-4-ylbenzoyl)amino]pent-4-enoate |
| SMILES | [H]/N=C(\N)c1cccc(CC(C(=O)OC)C(C=Cc2ccccc2)NC(=O)c2ccc(-c3ccncc3)cc2)c1 |
| InChI | InChI=1S/C32H30N4O3/c1-39-32(38)28(21-23-8-5-9-27(20-23)30(33)34)29(15-10-22-6-3-2-4-7-22)36-31(37)26-13-11-24(12-14-26)25-16-18-35-19-17-25/h2-20,28-29H,21H2,1H3,(H3,33,34)(H,36,37) |
| InChIKey | QGGHOQCQMZVANZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 118.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|