C21H28N2O — CID 54226596
3-[[2-[2-(3,5-dimethylphenyl)ethenyl]-6-methyl-3-pyridinyl]oxy]-N,N-dimethylpropan-1-amine (PubChem CID 54226596) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is 3-[[2-[2-(3,5-dimethylphenyl)ethenyl]-6-methyl-3-pyridinyl]oxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[[2-[2-(3,5-dimethylphenyl)ethenyl]-6-methyl-3-pyridinyl]oxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 54226596 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 3-[[2-[2-(3,5-dimethylphenyl)ethenyl]-6-methyl-3-pyridinyl]oxy]-N,N-dimethylpropan-1-amine |
| SMILES | Cc1cc(C)cc(C=Cc2nc(C)ccc2OCCCN(C)C)c1 |
| InChI | InChI=1S/C21H28N2O/c1-16-13-17(2)15-19(14-16)8-9-20-21(10-7-18(3)22-20)24-12-6-11-23(4)5/h7-10,13-15H,6,11-12H2,1-5H3 |
| InChIKey | QGHDGXBGUUKSRX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|