About (E)-3-[6-methyl-3-(4,4,4-trifluorobutoxy)-2-pyridinyl]prop-2-enoic acid
(E)-3-[6-methyl-3-(4,4,4-trifluorobutoxy)-2-pyridinyl]prop-2-enoic acid (PubChem CID 115514451) has the molecular formula C13H14F3NO3
and a molecular weight of 289.25 g/mol. Its IUPAC name is (E)-3-[6-methyl-3-(4,4,4-trifluorobutoxy)-2-pyridinyl]prop-2-enoic acid.
Molecular Properties
| Compound Name | (E)-3-[6-methyl-3-(4,4,4-trifluorobutoxy)-2-pyridinyl]prop-2-enoic acid |
| PubChem CID | 115514451 |
| Molecular Formula | C13H14F3NO3 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | (E)-3-[6-methyl-3-(4,4,4-trifluorobutoxy)-2-pyridinyl]prop-2-enoic acid |
| SMILES | Cc1ccc(OCCCC(F)(F)F)c(/C=C/C(=O)O)n1 |
| InChI | InChI=1S/C13H14F3NO3/c1-9-3-5-11(10(17-9)4-6-12(18)19)20-8-2-7-13(14,15)16/h3-6H,2,7-8H2,1H3,(H,18,19)/b6-4+ |
| InChIKey | OTDQSHRURKQXQW-GQCTYLIASA-N |
| XLogP | 3.21 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[6-methyl-3-(4,4,4-trifluorobutoxy)-2-pyridinyl]prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[6-methyl-3-(4,4,4-trifluorobutoxy)-2-pyridinyl]prop-2-enoic acid?
The IUPAC name of (E)-3-[6-methyl-3-(4,4,4-trifluorobutoxy)-2-pyridinyl]prop-2-enoic acid (CID 115514451) is (E)-3-[6-methyl-3-(4,4,4-trifluorobutoxy)-2-pyridinyl]prop-2-enoic acid.
What is the SMILES notation for (E)-3-[6-methyl-3-(4,4,4-trifluorobutoxy)-2-pyridinyl]prop-2-enoic acid?
The canonical SMILES for (E)-3-[6-methyl-3-(4,4,4-trifluorobutoxy)-2-pyridinyl]prop-2-enoic acid is Cc1ccc(OCCCC(F)(F)F)c(/C=C/C(=O)O)n1.
What is the InChIKey of (E)-3-[6-methyl-3-(4,4,4-trifluorobutoxy)-2-pyridinyl]prop-2-enoic acid?
The InChIKey is OTDQSHRURKQXQW-GQCTYLIASA-N. The full InChI is InChI=1S/C13H14F3NO3/c1-9-3-5-11(10(17-9)4-6-12(18)19)20-8-2-7-13(14,15)16/h3-6H,2,7-8H2,1H3,(H,18,19)/b6-4+.
What are the key properties of (E)-3-[6-methyl-3-(4,4,4-trifluorobutoxy)-2-pyridinyl]prop-2-enoic acid?
(E)-3-[6-methyl-3-(4,4,4-trifluorobutoxy)-2-pyridinyl]prop-2-enoic acid has a molecular weight of 289.25 g/mol, XLogP of 3.21, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[6-methyl-3-(4,4,4-trifluorobutoxy)-2-pyridinyl]prop-2-enoic acid is sourced from PubChem (CID 115514451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).