C16H21NO3 — CID 82929379
(E)-3-(3-cycloheptyloxy-6-methyl-2-pyridinyl)prop-2-enoic acid (PubChem CID 82929379) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is (E)-3-(3-cycloheptyloxy-6-methyl-2-pyridinyl)prop-2-enoic acid.
| Compound Name | (E)-3-(3-cycloheptyloxy-6-methyl-2-pyridinyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 82929379 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (E)-3-(3-cycloheptyloxy-6-methyl-2-pyridinyl)prop-2-enoic acid |
| SMILES | Cc1ccc(OC2CCCCCC2)c(/C=C/C(=O)O)n1 |
| InChI | InChI=1S/C16H21NO3/c1-12-8-10-15(14(17-12)9-11-16(18)19)20-13-6-4-2-3-5-7-13/h8-11,13H,2-7H2,1H3,(H,18,19)/b11-9+ |
| InChIKey | NZCGGNXWOKBUFZ-PKNBQFBNSA-N |
| XLogP | 3.59 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|