C17H12ClN3O4S — CID 54227109
2-oxo-6-[3-(pyridin-3-ylsulfonylamino)phenyl]-1H-pyridine-3-carbonyl chloride (PubChem CID 54227109) has the molecular formula C17H12ClN3O4S and a molecular weight of 389.82 g/mol. Its IUPAC name is 2-oxo-6-[3-(pyridin-3-ylsulfonylamino)phenyl]-1H-pyridine-3-carbonyl chloride.
| Compound Name | 2-oxo-6-[3-(pyridin-3-ylsulfonylamino)phenyl]-1H-pyridine-3-carbonyl chloride |
|---|---|
| PubChem CID | 54227109 |
| Molecular Formula | C17H12ClN3O4S |
| Molecular Weight | 389.82 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | 2-oxo-6-[3-(pyridin-3-ylsulfonylamino)phenyl]-1H-pyridine-3-carbonyl chloride |
| SMILES | O=C(Cl)c1ccc(-c2cccc(NS(=O)(=O)c3cccnc3)c2)[nH]c1=O |
| InChI | InChI=1S/C17H12ClN3O4S/c18-16(22)14-6-7-15(20-17(14)23)11-3-1-4-12(9-11)21-26(24,25)13-5-2-8-19-10-13/h1-10,21H,(H,20,23) |
| InChIKey | QGPWKARWCWWBFJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.82 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|