C17H13N3O5S — CID 22750275
2-oxo-6-[4-(pyridin-3-ylsulfamoyl)phenyl]-1H-pyridine-3-carboxylic acid (PubChem CID 22750275) has the molecular formula C17H13N3O5S and a molecular weight of 371.37 g/mol. Its IUPAC name is 2-oxo-6-[4-(pyridin-3-ylsulfamoyl)phenyl]-1H-pyridine-3-carboxylic acid.
| Compound Name | 2-oxo-6-[4-(pyridin-3-ylsulfamoyl)phenyl]-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 22750275 |
| Molecular Formula | C17H13N3O5S |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 2-oxo-6-[4-(pyridin-3-ylsulfamoyl)phenyl]-1H-pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(S(=O)(=O)Nc3cccnc3)cc2)[nH]c1=O |
| InChI | InChI=1S/C17H13N3O5S/c21-16-14(17(22)23)7-8-15(19-16)11-3-5-13(6-4-11)26(24,25)20-12-2-1-9-18-10-12/h1-10,20H,(H,19,21)(H,22,23) |
| InChIKey | QHWPNANNWFBDGK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 129.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |