C13H14N2O3 — CID 91141021
ethane;2-oxo-6-pyridin-4-yl-1H-pyridine-3-carboxylic acid (PubChem CID 91141021) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is ethane;2-oxo-6-pyridin-4-yl-1H-pyridine-3-carboxylic acid.
| Compound Name | ethane;2-oxo-6-pyridin-4-yl-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 91141021 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | ethane;2-oxo-6-pyridin-4-yl-1H-pyridine-3-carboxylic acid |
| SMILES | CC.O=C(O)c1ccc(-c2ccncc2)[nH]c1=O |
| InChI | InChI=1S/C11H8N2O3.C2H6/c14-10-8(11(15)16)1-2-9(13-10)7-3-5-12-6-4-7;1-2/h1-6H,(H,13,14)(H,15,16);1-2H3 |
| InChIKey | URZXUFQAWNRJLG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |