ethane;2-oxo-6-pyridin-4-yl-1H-pyridine-3-carboxylic acid

C13H14N2O3 — CID 91141021

IUPACethane;2-oxo-6-pyridin-4-yl-1H-pyridine-3-carboxylic acid
SMILESCC.O=C(O)c1ccc(-c2ccncc2)[nH]c1=O
InChIInChI=1S/C11H8N2O3.C2H6/c14-10-8(11(15)16)1-2-9(13-10)7-3-5-12-6-4-7;1-2/h1-6H,(H,13,14)(H,15,16);1-2H3
InChIKeyURZXUFQAWNRJLG-UHFFFAOYSA-N
MW246.27 g/mol
LogP2.16
Rot. Bonds2

About ethane;2-oxo-6-pyridin-4-yl-1H-pyridine-3-carboxylic acid

ethane;2-oxo-6-pyridin-4-yl-1H-pyridine-3-carboxylic acid (PubChem CID 91141021) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is ethane;2-oxo-6-pyridin-4-yl-1H-pyridine-3-carboxylic acid.

Molecular Properties

Compound Nameethane;2-oxo-6-pyridin-4-yl-1H-pyridine-3-carboxylic acid
PubChem CID91141021
Molecular FormulaC13H14N2O3
Molecular Weight246.27 g/mol
Exact Mass246.10
IUPAC Nameethane;2-oxo-6-pyridin-4-yl-1H-pyridine-3-carboxylic acid
SMILESCC.O=C(O)c1ccc(-c2ccncc2)[nH]c1=O
InChIInChI=1S/C11H8N2O3.C2H6/c14-10-8(11(15)16)1-2-9(13-10)7-3-5-12-6-4-7;1-2/h1-6H,(H,13,14)(H,15,16);1-2H3
InChIKeyURZXUFQAWNRJLG-UHFFFAOYSA-N
XLogP2.16
TPSA83.05 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.27
LogP ≤ 52.16
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze ethane;2-oxo-6-pyridin-4-yl-1H-pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;2-oxo-6-pyridin-4-yl-1H-pyridine-3-carboxylic acid?
The IUPAC name of ethane;2-oxo-6-pyridin-4-yl-1H-pyridine-3-carboxylic acid (CID 91141021) is ethane;2-oxo-6-pyridin-4-yl-1H-pyridine-3-carboxylic acid.
What is the SMILES notation for ethane;2-oxo-6-pyridin-4-yl-1H-pyridine-3-carboxylic acid?
The canonical SMILES for ethane;2-oxo-6-pyridin-4-yl-1H-pyridine-3-carboxylic acid is CC.O=C(O)c1ccc(-c2ccncc2)[nH]c1=O.
What is the InChIKey of ethane;2-oxo-6-pyridin-4-yl-1H-pyridine-3-carboxylic acid?
The InChIKey is URZXUFQAWNRJLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O3.C2H6/c14-10-8(11(15)16)1-2-9(13-10)7-3-5-12-6-4-7;1-2/h1-6H,(H,13,14)(H,15,16);1-2H3.
What are the key properties of ethane;2-oxo-6-pyridin-4-yl-1H-pyridine-3-carboxylic acid?
ethane;2-oxo-6-pyridin-4-yl-1H-pyridine-3-carboxylic acid has a molecular weight of 246.27 g/mol, XLogP of 2.16, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-oxo-6-pyridin-4-yl-1H-pyridine-3-carboxylic acid is sourced from PubChem (CID 91141021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).