C18H18N2O — CID 54228518
N-benzyl-N,4-dimethyl-2-phenyl-1,3-oxazol-5-amine (PubChem CID 54228518) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is N-benzyl-N,4-dimethyl-2-phenyl-1,3-oxazol-5-amine.
| Compound Name | N-benzyl-N,4-dimethyl-2-phenyl-1,3-oxazol-5-amine |
|---|---|
| PubChem CID | 54228518 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | N-benzyl-N,4-dimethyl-2-phenyl-1,3-oxazol-5-amine |
| SMILES | Cc1nc(-c2ccccc2)oc1N(C)Cc1ccccc1 |
| InChI | InChI=1S/C18H18N2O/c1-14-18(20(2)13-15-9-5-3-6-10-15)21-17(19-14)16-11-7-4-8-12-16/h3-12H,13H2,1-2H3 |
| InChIKey | QHOAWKSXZVHQBC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |