About N-benzyl-N,4-dimethyl-2-phenyl-1,3-oxazol-5-amine
N-benzyl-N,4-dimethyl-2-phenyl-1,3-oxazol-5-amine (PubChem CID 54228518) has the molecular formula C18H18N2O
and a molecular weight of 278.36 g/mol. Its IUPAC name is N-benzyl-N,4-dimethyl-2-phenyl-1,3-oxazol-5-amine.
Molecular Properties
| Compound Name | N-benzyl-N,4-dimethyl-2-phenyl-1,3-oxazol-5-amine |
| PubChem CID | 54228518 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | N-benzyl-N,4-dimethyl-2-phenyl-1,3-oxazol-5-amine |
| SMILES | Cc1nc(-c2ccccc2)oc1N(C)Cc1ccccc1 |
| InChI | InChI=1S/C18H18N2O/c1-14-18(20(2)13-15-9-5-3-6-10-15)21-17(19-14)16-11-7-4-8-12-16/h3-12H,13H2,1-2H3 |
| InChIKey | QHOAWKSXZVHQBC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-N,4-dimethyl-2-phenyl-1,3-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N,4-dimethyl-2-phenyl-1,3-oxazol-5-amine?
The IUPAC name of N-benzyl-N,4-dimethyl-2-phenyl-1,3-oxazol-5-amine (CID 54228518) is N-benzyl-N,4-dimethyl-2-phenyl-1,3-oxazol-5-amine.
What is the SMILES notation for N-benzyl-N,4-dimethyl-2-phenyl-1,3-oxazol-5-amine?
The canonical SMILES for N-benzyl-N,4-dimethyl-2-phenyl-1,3-oxazol-5-amine is Cc1nc(-c2ccccc2)oc1N(C)Cc1ccccc1.
What is the InChIKey of N-benzyl-N,4-dimethyl-2-phenyl-1,3-oxazol-5-amine?
The InChIKey is QHOAWKSXZVHQBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O/c1-14-18(20(2)13-15-9-5-3-6-10-15)21-17(19-14)16-11-7-4-8-12-16/h3-12H,13H2,1-2H3.
What are the key properties of N-benzyl-N,4-dimethyl-2-phenyl-1,3-oxazol-5-amine?
N-benzyl-N,4-dimethyl-2-phenyl-1,3-oxazol-5-amine has a molecular weight of 278.36 g/mol, XLogP of 4.29, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N,4-dimethyl-2-phenyl-1,3-oxazol-5-amine is sourced from PubChem (CID 54228518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).