C31H26N6O5 — CID 54229278
2-[4-[[2-butyl-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]benzimidazol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 54229278) has the molecular formula C31H26N6O5 and a molecular weight of 562.59 g/mol. Its IUPAC name is 2-[4-[[2-butyl-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]benzimidazol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[2-butyl-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]benzimidazol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 54229278 |
| Molecular Formula | C31H26N6O5 |
| Molecular Weight | 562.59 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | 2-[4-[[2-butyl-6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]benzimidazol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | CCCCc1nc2ccc(Nc3ccc([N+](=O)[O-])c4nonc34)cc2n1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C31H26N6O5/c1-2-3-8-28-33-24-14-13-21(32-25-15-16-26(37(40)41)30-29(25)34-42-35-30)17-27(24)36(28)18-19-9-11-20(12-10-19)22-6-4-5-7-23(22)31(38)39/h4-7,9-17,32H,2-3,8,18H2,1H3,(H,38,39) |
| InChIKey | QIBZEQIXJRJKHI-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 149.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.59 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|