C9H16N4OS2 — CID 54229358
N-[2-(diethylamino)ethyl]-2-sulfanylidene-3H-1,3,4-thiadiazole-5-carboxamide (PubChem CID 54229358) has the molecular formula C9H16N4OS2 and a molecular weight of 260.39 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-2-sulfanylidene-3H-1,3,4-thiadiazole-5-carboxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-2-sulfanylidene-3H-1,3,4-thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 54229358 |
| Molecular Formula | C9H16N4OS2 |
| Molecular Weight | 260.39 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-2-sulfanylidene-3H-1,3,4-thiadiazole-5-carboxamide |
| SMILES | CCN(CC)CCNC(=O)c1n[nH]c(=S)s1 |
| InChI | InChI=1S/C9H16N4OS2/c1-3-13(4-2)6-5-10-7(14)8-11-12-9(15)16-8/h3-6H2,1-2H3,(H,10,14)(H,12,15) |
| InChIKey | QIDGIQXLJLLGCC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.39 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|