C8H12O — CID 54232129
3,4-dimethylcyclohexa-1,3-dien-1-ol (PubChem CID 54232129) has the molecular formula C8H12O and a molecular weight of 124.18 g/mol. Its IUPAC name is 3,4-dimethylcyclohexa-1,3-dien-1-ol.
| Compound Name | 3,4-dimethylcyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 54232129 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | 3,4-dimethylcyclohexa-1,3-dien-1-ol |
| SMILES | CC1=C(C)CCC(O)=C1 |
| InChI | InChI=1S/C8H12O/c1-6-3-4-8(9)5-7(6)2/h5,9H,3-4H2,1-2H3 |
| InChIKey | QKAHMGDEXATUFK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |