C10H10O — CID 101083012
2,3-dihydronaphthalen-1-ol (PubChem CID 101083012) has the molecular formula C10H10O and a molecular weight of 146.19 g/mol. Its IUPAC name is 2,3-dihydronaphthalen-1-ol.
| Compound Name | 2,3-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 101083012 |
| Molecular Formula | C10H10O |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 2,3-dihydronaphthalen-1-ol |
| SMILES | OC1=c2ccccc2=CCC1 |
| InChI | InChI=1S/C10H10O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-2,4-6,11H,3,7H2 |
| InChIKey | RFHJPRUPMRVOQN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |