C12H15F3N4O3S — CID 54233820
N-[2-[(3-hydroxy-2-pyridinyl)methylsulfanyl]ethyl]-2-nitro-N'-(2,2,2-trifluoroethyl)ethanimidamide (PubChem CID 54233820) has the molecular formula C12H15F3N4O3S and a molecular weight of 352.34 g/mol. Its IUPAC name is N-[2-[(3-hydroxy-2-pyridinyl)methylsulfanyl]ethyl]-2-nitro-N'-(2,2,2-trifluoroethyl)ethanimidamide.
| Compound Name | N-[2-[(3-hydroxy-2-pyridinyl)methylsulfanyl]ethyl]-2-nitro-N'-(2,2,2-trifluoroethyl)ethanimidamide |
|---|---|
| PubChem CID | 54233820 |
| Molecular Formula | C12H15F3N4O3S |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | N-[2-[(3-hydroxy-2-pyridinyl)methylsulfanyl]ethyl]-2-nitro-N'-(2,2,2-trifluoroethyl)ethanimidamide |
| SMILES | O=[N+]([O-])C/C(=N\CC(F)(F)F)NCCSCc1ncccc1O |
| InChI | InChI=1S/C12H15F3N4O3S/c13-12(14,15)8-18-11(6-19(21)22)17-4-5-23-7-9-10(20)2-1-3-16-9/h1-3,20H,4-8H2,(H,17,18) |
| InChIKey | QLCZHXZOWMRKRI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|