C10H7Cl2N3O — CID 54233902
(2,6-dichloro-4-pyridinyl)-(1-methylimidazol-2-yl)methanone (PubChem CID 54233902) has the molecular formula C10H7Cl2N3O and a molecular weight of 256.09 g/mol. Its IUPAC name is (2,6-dichloro-4-pyridinyl)-(1-methylimidazol-2-yl)methanone.
| Compound Name | (2,6-dichloro-4-pyridinyl)-(1-methylimidazol-2-yl)methanone |
|---|---|
| PubChem CID | 54233902 |
| Molecular Formula | C10H7Cl2N3O |
| Molecular Weight | 256.09 g/mol |
| Exact Mass | 255.00 |
| IUPAC Name | (2,6-dichloro-4-pyridinyl)-(1-methylimidazol-2-yl)methanone |
| SMILES | Cn1ccnc1C(=O)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C10H7Cl2N3O/c1-15-3-2-13-10(15)9(16)6-4-7(11)14-8(12)5-6/h2-5H,1H3 |
| InChIKey | QLEMLAIVRVZZGL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.09 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|