C11H7ClF2N2O — CID 82772383
(4-chloro-2,5-difluorophenyl)-(1-methylimidazol-2-yl)methanone (PubChem CID 82772383) has the molecular formula C11H7ClF2N2O and a molecular weight of 256.64 g/mol. Its IUPAC name is (4-chloro-2,5-difluorophenyl)-(1-methylimidazol-2-yl)methanone.
| Compound Name | (4-chloro-2,5-difluorophenyl)-(1-methylimidazol-2-yl)methanone |
|---|---|
| PubChem CID | 82772383 |
| Molecular Formula | C11H7ClF2N2O |
| Molecular Weight | 256.64 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | (4-chloro-2,5-difluorophenyl)-(1-methylimidazol-2-yl)methanone |
| SMILES | Cn1ccnc1C(=O)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C11H7ClF2N2O/c1-16-3-2-15-11(16)10(17)6-4-9(14)7(12)5-8(6)13/h2-5H,1H3 |
| InChIKey | CAXJKGLAPMCRPK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.64 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|