C19H30FNO2 — CID 54234416
7-[(4-fluorophenyl)methylamino]-4,4,8-trimethylnonanoic acid (PubChem CID 54234416) has the molecular formula C19H30FNO2 and a molecular weight of 323.45 g/mol. Its IUPAC name is 7-[(4-fluorophenyl)methylamino]-4,4,8-trimethylnonanoic acid.
| Compound Name | 7-[(4-fluorophenyl)methylamino]-4,4,8-trimethylnonanoic acid |
|---|---|
| PubChem CID | 54234416 |
| Molecular Formula | C19H30FNO2 |
| Molecular Weight | 323.45 g/mol |
| Exact Mass | 323.23 |
| IUPAC Name | 7-[(4-fluorophenyl)methylamino]-4,4,8-trimethylnonanoic acid |
| SMILES | CC(C)C(CCC(C)(C)CCC(=O)O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H30FNO2/c1-14(2)17(9-11-19(3,4)12-10-18(22)23)21-13-15-5-7-16(20)8-6-15/h5-8,14,17,21H,9-13H2,1-4H3,(H,22,23) |
| InChIKey | QLNNTPIHXOQRMY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |