C23H24F3NO2 — CID 54235360
3,3,6,6-tetramethyl-9-(2,4,6-trifluorophenyl)-2,4,5,7,8a,9-hexahydroacridine-1,8-dione (PubChem CID 54235360) has the molecular formula C23H24F3NO2 and a molecular weight of 403.44 g/mol. Its IUPAC name is 3,3,6,6-tetramethyl-9-(2,4,6-trifluorophenyl)-2,4,5,7,8a,9-hexahydroacridine-1,8-dione.
| Compound Name | 3,3,6,6-tetramethyl-9-(2,4,6-trifluorophenyl)-2,4,5,7,8a,9-hexahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 54235360 |
| Molecular Formula | C23H24F3NO2 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 3,3,6,6-tetramethyl-9-(2,4,6-trifluorophenyl)-2,4,5,7,8a,9-hexahydroacridine-1,8-dione |
| SMILES | CC1(C)CC(=O)C2C(=NC3=C(C(=O)CC(C)(C)C3)C2c2c(F)cc(F)cc2F)C1 |
| InChI | InChI=1S/C23H24F3NO2/c1-22(2)7-14-19(16(28)9-22)21(18-12(25)5-11(24)6-13(18)26)20-15(27-14)8-23(3,4)10-17(20)29/h5-6,19,21H,7-10H2,1-4H3 |
| InChIKey | QMELZXSKJUIJJS-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |