C44H32N4O — CID 54235932
4-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)phenol (PubChem CID 54235932) has the molecular formula C44H32N4O and a molecular weight of 632.77 g/mol. Its IUPAC name is 4-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)phenol.
| Compound Name | 4-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)phenol |
|---|---|
| PubChem CID | 54235932 |
| Molecular Formula | C44H32N4O |
| Molecular Weight | 632.77 g/mol |
| Exact Mass | 632.26 |
| IUPAC Name | 4-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)phenol |
| SMILES | Oc1ccc(C2=c3ccc([nH]3)=C(c3ccccc3)c3ccc([nH]3)C(c3ccccc3)=c3ccc([nH]3)=C(c3ccccc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C44H32N4O/c49-32-18-16-31(17-19-32)44-39-26-24-37(47-39)42(29-12-6-2-7-13-29)35-22-20-33(45-35)41(28-10-4-1-5-11-28)34-21-23-36(46-34)43(30-14-8-3-9-15-30)38-25-27-40(44)48-38/h1-27,45-49H |
| InChIKey | LTTQKPOBKJUMRX-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.77 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 1 |