C20H30O4 — CID 54237257
1-(3,4-dihydroxyphenyl)-5-hydroxytetradec-1-en-3-one (PubChem CID 54237257) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-5-hydroxytetradec-1-en-3-one.
| Compound Name | 1-(3,4-dihydroxyphenyl)-5-hydroxytetradec-1-en-3-one |
|---|---|
| PubChem CID | 54237257 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-5-hydroxytetradec-1-en-3-one |
| SMILES | CCCCCCCCCC(O)CC(=O)C=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C20H30O4/c1-2-3-4-5-6-7-8-9-17(21)15-18(22)12-10-16-11-13-19(23)20(24)14-16/h10-14,17,21,23-24H,2-9,15H2,1H3 |
| InChIKey | QNKXUUSZBGEENJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|