C11H8I2O3 — CID 54237497
3-(2,2-diiodoethoxy)chromen-2-one (PubChem CID 54237497) has the molecular formula C11H8I2O3 and a molecular weight of 441.99 g/mol. Its IUPAC name is 3-(2,2-diiodoethoxy)chromen-2-one.
| Compound Name | 3-(2,2-diiodoethoxy)chromen-2-one |
|---|---|
| PubChem CID | 54237497 |
| Molecular Formula | C11H8I2O3 |
| Molecular Weight | 441.99 g/mol |
| Exact Mass | 441.86 |
| IUPAC Name | 3-(2,2-diiodoethoxy)chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1OCC(I)I |
| InChI | InChI=1S/C11H8I2O3/c12-10(13)6-15-9-5-7-3-1-2-4-8(7)16-11(9)14/h1-5,10H,6H2 |
| InChIKey | QNPFDHFBPOLRHS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.99 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|