C22H18F3N5O4 — CID 54237917
1-(2,4-difluorophenyl)-6-fluoro-7-(8-methoxyimino-2,6-diazaspiro[3.4]octan-6-yl)-4-oxo-1,8-naphthyridine-3-carboxylic acid (PubChem CID 54237917) has the molecular formula C22H18F3N5O4 and a molecular weight of 473.41 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-6-fluoro-7-(8-methoxyimino-2,6-diazaspiro[3.4]octan-6-yl)-4-oxo-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 1-(2,4-difluorophenyl)-6-fluoro-7-(8-methoxyimino-2,6-diazaspiro[3.4]octan-6-yl)-4-oxo-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 54237917 |
| Molecular Formula | C22H18F3N5O4 |
| Molecular Weight | 473.41 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 1-(2,4-difluorophenyl)-6-fluoro-7-(8-methoxyimino-2,6-diazaspiro[3.4]octan-6-yl)-4-oxo-1,8-naphthyridine-3-carboxylic acid |
| SMILES | CON=C1CN(c2nc3c(cc2F)c(=O)c(C(=O)O)cn3-c2ccc(F)cc2F)CC12CNC2 |
| InChI | InChI=1S/C22H18F3N5O4/c1-34-28-17-7-29(10-22(17)8-26-9-22)20-15(25)5-12-18(31)13(21(32)33)6-30(19(12)27-20)16-3-2-11(23)4-14(16)24/h2-6,26H,7-10H2,1H3,(H,32,33) |
| InChIKey | QNWYSGLABSRVBB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|