C9H17BrO4 — CID 54237980
2-bromo-1,1,5,5-tetramethoxypent-2-ene (PubChem CID 54237980) has the molecular formula C9H17BrO4 and a molecular weight of 269.13 g/mol. Its IUPAC name is 2-bromo-1,1,5,5-tetramethoxypent-2-ene.
| Compound Name | 2-bromo-1,1,5,5-tetramethoxypent-2-ene |
|---|---|
| PubChem CID | 54237980 |
| Molecular Formula | C9H17BrO4 |
| Molecular Weight | 269.13 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 2-bromo-1,1,5,5-tetramethoxypent-2-ene |
| SMILES | COC(CC=C(Br)C(OC)OC)OC |
| InChI | InChI=1S/C9H17BrO4/c1-11-8(12-2)6-5-7(10)9(13-3)14-4/h5,8-9H,6H2,1-4H3 |
| InChIKey | QNXXHNRMIFHUFD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.13 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|