About 2-bromo-1,1,5,5-tetramethoxypent-2-ene
2-bromo-1,1,5,5-tetramethoxypent-2-ene (PubChem CID 54237980) has the molecular formula C9H17BrO4
and a molecular weight of 269.13 g/mol. Its IUPAC name is 2-bromo-1,1,5,5-tetramethoxypent-2-ene.
Molecular Properties
| Compound Name | 2-bromo-1,1,5,5-tetramethoxypent-2-ene |
| PubChem CID | 54237980 |
| Molecular Formula | C9H17BrO4 |
| Molecular Weight | 269.13 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 2-bromo-1,1,5,5-tetramethoxypent-2-ene |
| SMILES | COC(CC=C(Br)C(OC)OC)OC |
| InChI | InChI=1S/C9H17BrO4/c1-11-8(12-2)6-5-7(10)9(13-3)14-4/h5,8-9H,6H2,1-4H3 |
| InChIKey | QNXXHNRMIFHUFD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.13 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1,1,5,5-tetramethoxypent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1,1,5,5-tetramethoxypent-2-ene?
The IUPAC name of 2-bromo-1,1,5,5-tetramethoxypent-2-ene (CID 54237980) is 2-bromo-1,1,5,5-tetramethoxypent-2-ene.
What is the SMILES notation for 2-bromo-1,1,5,5-tetramethoxypent-2-ene?
The canonical SMILES for 2-bromo-1,1,5,5-tetramethoxypent-2-ene is COC(CC=C(Br)C(OC)OC)OC.
What is the InChIKey of 2-bromo-1,1,5,5-tetramethoxypent-2-ene?
The InChIKey is QNXXHNRMIFHUFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17BrO4/c1-11-8(12-2)6-5-7(10)9(13-3)14-4/h5,8-9H,6H2,1-4H3.
What are the key properties of 2-bromo-1,1,5,5-tetramethoxypent-2-ene?
2-bromo-1,1,5,5-tetramethoxypent-2-ene has a molecular weight of 269.13 g/mol, XLogP of 1.89, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1,1,5,5-tetramethoxypent-2-ene is sourced from PubChem (CID 54237980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).