C37H44N2O4 — CID 54239351
tert-butyl (1S,3aS,3bS,9aR,9bS,11aS)-1-(9H-fluoren-9-ylcarbamoyl)-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridine-5-carboxylate (PubChem CID 54239351) has the molecular formula C37H44N2O4 and a molecular weight of 580.77 g/mol. Its IUPAC name is tert-butyl (1S,3aS,3bS,9aR,9bS,11aS)-1-(9H-fluoren-9-ylcarbamoyl)-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridine-5-carboxylate.
| Compound Name | tert-butyl (1S,3aS,3bS,9aR,9bS,11aS)-1-(9H-fluoren-9-ylcarbamoyl)-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridine-5-carboxylate |
|---|---|
| PubChem CID | 54239351 |
| Molecular Formula | C37H44N2O4 |
| Molecular Weight | 580.77 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | tert-butyl (1S,3aS,3bS,9aR,9bS,11aS)-1-(9H-fluoren-9-ylcarbamoyl)-9a,11a-dimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2[C@@H]3CC[C@H](C(=O)NC4c5ccccc5-c5ccccc54)[C@@]3(C)CC[C@@H]2[C@@]2(C)CCC(=O)C=C12 |
| InChI | InChI=1S/C37H44N2O4/c1-35(2,3)43-34(42)39-21-27-28-14-15-30(36(28,4)19-17-29(27)37(5)18-16-22(40)20-31(37)39)33(41)38-32-25-12-8-6-10-23(25)24-11-7-9-13-26(24)32/h6-13,20,27-30,32H,14-19,21H2,1-5H3,(H,38,41)/t27-,28-,29-,30+,36-,37+/m0/s1 |
| InChIKey | QOWWHRRMAWKPOE-FVWZXMSJSA-N |
| XLogP | 7.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.77 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |