C37H42F6N2O4 — CID 176941730
(9aR,11aS)-N-[bis[4-(trifluoromethoxy)phenyl]methyl]-9a,11a-dimethyl-7-oxo-5-propyl-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridine-1-carboxamide (PubChem CID 176941730) has the molecular formula C37H42F6N2O4 and a molecular weight of 692.74 g/mol. Its IUPAC name is (9aR,11aS)-N-[bis[4-(trifluoromethoxy)phenyl]methyl]-9a,11a-dimethyl-7-oxo-5-propyl-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridine-1-carboxamide.
| Compound Name | (9aR,11aS)-N-[bis[4-(trifluoromethoxy)phenyl]methyl]-9a,11a-dimethyl-7-oxo-5-propyl-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridine-1-carboxamide |
|---|---|
| PubChem CID | 176941730 |
| Molecular Formula | C37H42F6N2O4 |
| Molecular Weight | 692.74 g/mol |
| Exact Mass | 692.30 |
| IUPAC Name | (9aR,11aS)-N-[bis[4-(trifluoromethoxy)phenyl]methyl]-9a,11a-dimethyl-7-oxo-5-propyl-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridine-1-carboxamide |
| SMILES | CCCN1CC2C3CCC(C(=O)NC(c4ccc(OC(F)(F)F)cc4)c4ccc(OC(F)(F)F)cc4)[C@@]3(C)CCC2[C@@]2(C)CCC(=O)C=C12 |
| InChI | InChI=1S/C37H42F6N2O4/c1-4-19-45-21-27-28-13-14-30(34(28,2)18-16-29(27)35(3)17-15-24(46)20-31(35)45)33(47)44-32(22-5-9-25(10-6-22)48-36(38,39)40)23-7-11-26(12-8-23)49-37(41,42)43/h5-12,20,27-30,32H,4,13-19,21H2,1-3H3,(H,44,47)/t27?,28?,29?,30?,34-,35+/m0/s1 |
| InChIKey | XEIJRJXRDIHZKO-UHHIORKDSA-N |
| XLogP | 8.73 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.74 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |