C33H39ClN2O2 — CID 67750890
(1S,3aS,3bS,9aR,9bS,11aS)-N-[(4-chlorophenyl)-phenylmethyl]-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-1-carboxamide (PubChem CID 67750890) has the molecular formula C33H39ClN2O2 and a molecular weight of 531.14 g/mol. Its IUPAC name is (1S,3aS,3bS,9aR,9bS,11aS)-N-[(4-chlorophenyl)-phenylmethyl]-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-1-carboxamide.
| Compound Name | (1S,3aS,3bS,9aR,9bS,11aS)-N-[(4-chlorophenyl)-phenylmethyl]-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-1-carboxamide |
|---|---|
| PubChem CID | 67750890 |
| Molecular Formula | C33H39ClN2O2 |
| Molecular Weight | 531.14 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | (1S,3aS,3bS,9aR,9bS,11aS)-N-[(4-chlorophenyl)-phenylmethyl]-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-1-carboxamide |
| SMILES | CN1C(=O)CC[C@@]2(C)C1=CC[C@H]1[C@@H]3CC[C@H](C(=O)NC(c4ccccc4)c4ccc(Cl)cc4)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C33H39ClN2O2/c1-32-19-17-26-24(13-16-28-33(26,2)20-18-29(37)36(28)3)25(32)14-15-27(32)31(38)35-30(21-7-5-4-6-8-21)22-9-11-23(34)12-10-22/h4-12,16,24-27,30H,13-15,17-20H2,1-3H3,(H,35,38)/t24-,25-,26-,27+,30?,32-,33+/m0/s1 |
| InChIKey | ABLDKICOYIZACM-QKFHILFJSA-N |
| XLogP | 7.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.14 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |