C30H38N2O2S2 — CID 67750818
(1S,3aS,3bS,9aR,9bS,11aS)-N-(1,2-dithiophen-2-ylethyl)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-1-carboxamide (PubChem CID 67750818) has the molecular formula C30H38N2O2S2 and a molecular weight of 522.78 g/mol. Its IUPAC name is (1S,3aS,3bS,9aR,9bS,11aS)-N-(1,2-dithiophen-2-ylethyl)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-1-carboxamide.
| Compound Name | (1S,3aS,3bS,9aR,9bS,11aS)-N-(1,2-dithiophen-2-ylethyl)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-1-carboxamide |
|---|---|
| PubChem CID | 67750818 |
| Molecular Formula | C30H38N2O2S2 |
| Molecular Weight | 522.78 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | (1S,3aS,3bS,9aR,9bS,11aS)-N-(1,2-dithiophen-2-ylethyl)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-indeno[5,4-f]quinoline-1-carboxamide |
| SMILES | CN1C(=O)CC[C@@]2(C)C1=CC[C@H]1[C@@H]3CC[C@H](C(=O)NC(Cc4cccs4)c4cccs4)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C30H38N2O2S2/c1-29-14-12-22-20(8-11-26-30(22,2)15-13-27(33)32(26)3)21(29)9-10-23(29)28(34)31-24(25-7-5-17-36-25)18-19-6-4-16-35-19/h4-7,11,16-17,20-24H,8-10,12-15,18H2,1-3H3,(H,31,34)/t20-,21-,22-,23+,24?,29-,30+/m0/s1 |
| InChIKey | NOYYBRKCYVBBIM-JBBXPZQFSA-N |
| XLogP | 6.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.78 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |