C33H35NO3 — CID 54134543
(8S,9S,13S,14S)-17-(benzhydrylcarbamoyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxylic acid (PubChem CID 54134543) has the molecular formula C33H35NO3 and a molecular weight of 493.65 g/mol. Its IUPAC name is (8S,9S,13S,14S)-17-(benzhydrylcarbamoyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxylic acid.
| Compound Name | (8S,9S,13S,14S)-17-(benzhydrylcarbamoyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxylic acid |
|---|---|
| PubChem CID | 54134543 |
| Molecular Formula | C33H35NO3 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | (8S,9S,13S,14S)-17-(benzhydrylcarbamoyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxylic acid |
| SMILES | C[C@]12CC[C@@H]3c4ccc(C(=O)O)cc4CC[C@H]3[C@@H]1CCC2C(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H35NO3/c1-33-19-18-26-25-14-13-24(32(36)37)20-23(25)12-15-27(26)28(33)16-17-29(33)31(35)34-30(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-11,13-14,20,26-30H,12,15-19H2,1H3,(H,34,35)(H,36,37)/t26-,27-,28+,29?,33+/m1/s1 |
| InChIKey | NWTBGRNUAXQKSZ-YOIFBMPCSA-N |
| XLogP | 6.76 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |