C26H37NO3 — CID 67804120
methyl (8R,9S,13S,14S,17S)-17-[acetyl(tert-butyl)amino]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxylate (PubChem CID 67804120) has the molecular formula C26H37NO3 and a molecular weight of 411.59 g/mol. Its IUPAC name is methyl (8R,9S,13S,14S,17S)-17-[acetyl(tert-butyl)amino]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxylate.
| Compound Name | methyl (8R,9S,13S,14S,17S)-17-[acetyl(tert-butyl)amino]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxylate |
|---|---|
| PubChem CID | 67804120 |
| Molecular Formula | C26H37NO3 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | methyl (8R,9S,13S,14S,17S)-17-[acetyl(tert-butyl)amino]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](N(C(C)=O)C(C)(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C26H37NO3/c1-16(28)27(25(2,3)4)23-12-11-22-21-10-7-17-15-18(24(29)30-6)8-9-19(17)20(21)13-14-26(22,23)5/h8-9,15,20-23H,7,10-14H2,1-6H3/t20-,21-,22+,23+,26+/m1/s1 |
| InChIKey | OVKXHWQNUIWBQJ-IOCWQACJSA-N |
| XLogP | 5.34 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |