C25H35NO3 — CID 10069646
methyl (8S,9S,13S,14S,17S)-17-(tert-butylcarbamoyl)-13-methyl-2,4-ditritio-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxylate (PubChem CID 10069646) has the molecular formula C25H35NO3 and a molecular weight of 401.58 g/mol. Its IUPAC name is methyl (8S,9S,13S,14S,17S)-17-(tert-butylcarbamoyl)-13-methyl-2,4-ditritio-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxylate.
| Compound Name | methyl (8S,9S,13S,14S,17S)-17-(tert-butylcarbamoyl)-13-methyl-2,4-ditritio-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxylate |
|---|---|
| PubChem CID | 10069646 |
| Molecular Formula | C25H35NO3 |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.28 |
| IUPAC Name | methyl (8S,9S,13S,14S,17S)-17-(tert-butylcarbamoyl)-13-methyl-2,4-ditritio-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxylate |
| SMILES | [3H]c1cc2c(c([3H])c1C(=O)OC)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](C(=O)NC(C)(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C25H35NO3/c1-24(2,3)26-22(27)21-11-10-20-19-9-6-15-14-16(23(28)29-5)7-8-17(15)18(19)12-13-25(20,21)4/h7-8,14,18-21H,6,9-13H2,1-5H3,(H,26,27)/t18-,19-,20+,21-,25+/m1/s1/i7T,14T |
| InChIKey | UBRRHEAKQZTILX-IMLZMYOBSA-N |
| XLogP | 4.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |