C27H29F3O5S — CID 22871644
trifluoromethyl (8S,9S,13S,14S,17S)-17-(4-methoxybenzoyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-sulfonate (PubChem CID 22871644) has the molecular formula C27H29F3O5S and a molecular weight of 522.59 g/mol. Its IUPAC name is trifluoromethyl (8S,9S,13S,14S,17S)-17-(4-methoxybenzoyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-sulfonate.
| Compound Name | trifluoromethyl (8S,9S,13S,14S,17S)-17-(4-methoxybenzoyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-sulfonate |
|---|---|
| PubChem CID | 22871644 |
| Molecular Formula | C27H29F3O5S |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | trifluoromethyl (8S,9S,13S,14S,17S)-17-(4-methoxybenzoyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-sulfonate |
| SMILES | COc1ccc(C(=O)[C@H]2CC[C@H]3[C@@H]4CCc5cc(S(=O)(=O)OC(F)(F)F)ccc5[C@H]4CC[C@]23C)cc1 |
| InChI | InChI=1S/C27H29F3O5S/c1-26-14-13-21-20-10-8-19(36(32,33)35-27(28,29)30)15-17(20)5-9-22(21)23(26)11-12-24(26)25(31)16-3-6-18(34-2)7-4-16/h3-4,6-8,10,15,21-24H,5,9,11-14H2,1-2H3/t21-,22-,23+,24-,26+/m1/s1 |
| InChIKey | WSJWZYHZCWUTIK-XCVFGXLCSA-N |
| XLogP | 6.28 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|